C24H36BrFO2 — CID 177029532
2-[1-bromo-2-[(2-methylpropan-2-yl)oxy]prop-2-enyl]-1-(1-cyclobutyl-2-methoxyhexan-3-yl)-4-fluorobenzene (PubChem CID 177029532) has the molecular formula C24H36BrFO2 and a molecular weight of 455.45 g/mol. Its IUPAC name is 2-[1-bromo-2-[(2-methylpropan-2-yl)oxy]prop-2-enyl]-1-(1-cyclobutyl-2-methoxyhexan-3-yl)-4-fluorobenzene.
| Compound Name | 2-[1-bromo-2-[(2-methylpropan-2-yl)oxy]prop-2-enyl]-1-(1-cyclobutyl-2-methoxyhexan-3-yl)-4-fluorobenzene |
|---|---|
| PubChem CID | 177029532 |
| Molecular Formula | C24H36BrFO2 |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 2-[1-bromo-2-[(2-methylpropan-2-yl)oxy]prop-2-enyl]-1-(1-cyclobutyl-2-methoxyhexan-3-yl)-4-fluorobenzene |
| SMILES | C=C(OC(C)(C)C)C(Br)c1cc(F)ccc1C(CCC)C(CC1CCC1)OC |
| InChI | InChI=1S/C24H36BrFO2/c1-7-9-20(22(27-6)14-17-10-8-11-17)19-13-12-18(26)15-21(19)23(25)16(2)28-24(3,4)5/h12-13,15,17,20,22-23H,2,7-11,14H2,1,3-6H3 |
| InChIKey | QACAMANMOACJJC-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|