C23H36O3 — CID 146417272
tert-butyl 2-[2-(5,5-dimethyloxan-2-yl)phenyl]hexanoate (PubChem CID 146417272) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is tert-butyl 2-[2-(5,5-dimethyloxan-2-yl)phenyl]hexanoate.
| Compound Name | tert-butyl 2-[2-(5,5-dimethyloxan-2-yl)phenyl]hexanoate |
|---|---|
| PubChem CID | 146417272 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | tert-butyl 2-[2-(5,5-dimethyloxan-2-yl)phenyl]hexanoate |
| SMILES | CCCCC(C(=O)OC(C)(C)C)c1ccccc1C1CCC(C)(C)CO1 |
| InChI | InChI=1S/C23H36O3/c1-7-8-11-19(21(24)26-22(2,3)4)17-12-9-10-13-18(17)20-14-15-23(5,6)16-25-20/h9-10,12-13,19-20H,7-8,11,14-16H2,1-6H3 |
| InChIKey | MVZUOINVZJEYLC-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |