C19H33NO5 — CID 15233228
tert-butyl N-[(2S)-1-(6,6-dimethyl-4,8-dioxaspiro[2.5]oct-1-en-2-yl)-1-hydroxyhexan-2-yl]carbamate (PubChem CID 15233228) has the molecular formula C19H33NO5 and a molecular weight of 355.48 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(6,6-dimethyl-4,8-dioxaspiro[2.5]oct-1-en-2-yl)-1-hydroxyhexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(6,6-dimethyl-4,8-dioxaspiro[2.5]oct-1-en-2-yl)-1-hydroxyhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 15233228 |
| Molecular Formula | C19H33NO5 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | tert-butyl N-[(2S)-1-(6,6-dimethyl-4,8-dioxaspiro[2.5]oct-1-en-2-yl)-1-hydroxyhexan-2-yl]carbamate |
| SMILES | CCCC[C@H](NC(=O)OC(C)(C)C)C(O)C1=CC12OCC(C)(C)CO2 |
| InChI | InChI=1S/C19H33NO5/c1-7-8-9-14(20-16(22)25-17(2,3)4)15(21)13-10-19(13)23-11-18(5,6)12-24-19/h10,14-15,21H,7-9,11-12H2,1-6H3,(H,20,22)/t14-,15?/m0/s1 |
| InChIKey | KWUUOIIRSDSBQP-MLCCFXAWSA-N |
| XLogP | 3.14 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|