C19H26N2 — CID 146429416
N-[(1E)-2-ethenyl-3-methyl-4-[(3Z)-3-pent-4-enylidene-1,2-dihydropyrrol-4-yl]penta-1,4-dienyl]ethanimine (PubChem CID 146429416) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-[(1E)-2-ethenyl-3-methyl-4-[(3Z)-3-pent-4-enylidene-1,2-dihydropyrrol-4-yl]penta-1,4-dienyl]ethanimine.
| Compound Name | N-[(1E)-2-ethenyl-3-methyl-4-[(3Z)-3-pent-4-enylidene-1,2-dihydropyrrol-4-yl]penta-1,4-dienyl]ethanimine |
|---|---|
| PubChem CID | 146429416 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N-[(1E)-2-ethenyl-3-methyl-4-[(3Z)-3-pent-4-enylidene-1,2-dihydropyrrol-4-yl]penta-1,4-dienyl]ethanimine |
| SMILES | C=CCC/C=C1\CNC=C1C(=C)C(C)/C(C=C)=C/N=C/C |
| InChI | InChI=1S/C19H26N2/c1-6-9-10-11-18-13-21-14-19(18)16(5)15(4)17(7-2)12-20-8-3/h6-8,11-12,14-15,21H,1-2,5,9-10,13H2,3-4H3/b17-12+,18-11+,20-8+ |
| InChIKey | GREKSXWZTRKUTO-NHLVAIQVSA-N |
| XLogP | 4.72 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|