About N-[2-(5,6-dihydro-1H-indol-3-yl)-1-phenylprop-2-enyl]-4-methylpyrimidin-2-amine
N-[2-(5,6-dihydro-1H-indol-3-yl)-1-phenylprop-2-enyl]-4-methylpyrimidin-2-amine (PubChem CID 146429421) has the molecular formula C22H22N4
and a molecular weight of 342.45 g/mol. Its IUPAC name is N-[2-(5,6-dihydro-1H-indol-3-yl)-1-phenylprop-2-enyl]-4-methylpyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[2-(5,6-dihydro-1H-indol-3-yl)-1-phenylprop-2-enyl]-4-methylpyrimidin-2-amine |
| PubChem CID | 146429421 |
| Molecular Formula | C22H22N4 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | N-[2-(5,6-dihydro-1H-indol-3-yl)-1-phenylprop-2-enyl]-4-methylpyrimidin-2-amine |
| SMILES | C=C(c1c[nH]c2c1=CCCC=2)C(Nc1nccc(C)n1)c1ccccc1 |
| InChI | InChI=1S/C22H22N4/c1-15-12-13-23-22(25-15)26-21(17-8-4-3-5-9-17)16(2)19-14-24-20-11-7-6-10-18(19)20/h3-5,8-14,21,24H,2,6-7H2,1H3,(H,23,25,26) |
| InChIKey | PNEDQXUTMIGSSZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(5,6-dihydro-1H-indol-3-yl)-1-phenylprop-2-enyl]-4-methylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(5,6-dihydro-1H-indol-3-yl)-1-phenylprop-2-enyl]-4-methylpyrimidin-2-amine?
The IUPAC name of N-[2-(5,6-dihydro-1H-indol-3-yl)-1-phenylprop-2-enyl]-4-methylpyrimidin-2-amine (CID 146429421) is N-[2-(5,6-dihydro-1H-indol-3-yl)-1-phenylprop-2-enyl]-4-methylpyrimidin-2-amine.
What is the SMILES notation for N-[2-(5,6-dihydro-1H-indol-3-yl)-1-phenylprop-2-enyl]-4-methylpyrimidin-2-amine?
The canonical SMILES for N-[2-(5,6-dihydro-1H-indol-3-yl)-1-phenylprop-2-enyl]-4-methylpyrimidin-2-amine is C=C(c1c[nH]c2c1=CCCC=2)C(Nc1nccc(C)n1)c1ccccc1.
What is the InChIKey of N-[2-(5,6-dihydro-1H-indol-3-yl)-1-phenylprop-2-enyl]-4-methylpyrimidin-2-amine?
The InChIKey is PNEDQXUTMIGSSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4/c1-15-12-13-23-22(25-15)26-21(17-8-4-3-5-9-17)16(2)19-14-24-20-11-7-6-10-18(19)20/h3-5,8-14,21,24H,2,6-7H2,1H3,(H,23,25,26).
What are the key properties of N-[2-(5,6-dihydro-1H-indol-3-yl)-1-phenylprop-2-enyl]-4-methylpyrimidin-2-amine?
N-[2-(5,6-dihydro-1H-indol-3-yl)-1-phenylprop-2-enyl]-4-methylpyrimidin-2-amine has a molecular weight of 342.45 g/mol, XLogP of 3.33, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(5,6-dihydro-1H-indol-3-yl)-1-phenylprop-2-enyl]-4-methylpyrimidin-2-amine is sourced from PubChem (CID 146429421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).