C10H16N2 — CID 146430751
6-methanimidoyl-2-propan-2-ylcyclohexa-1,5-dien-1-amine (PubChem CID 146430751) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 6-methanimidoyl-2-propan-2-ylcyclohexa-1,5-dien-1-amine.
| Compound Name | 6-methanimidoyl-2-propan-2-ylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 146430751 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 6-methanimidoyl-2-propan-2-ylcyclohexa-1,5-dien-1-amine |
| SMILES | [H]/N=C/C1=CCCC(C(C)C)=C1N |
| InChI | InChI=1S/C10H16N2/c1-7(2)9-5-3-4-8(6-11)10(9)12/h4,6-7,11H,3,5,12H2,1-2H3/b11-6+ |
| InChIKey | RDIHJXKBHXRUDO-IZZDOVSWSA-N |
| XLogP | 2.22 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|