C8H14N2 — CID 142083618
2-methanimidoyl-5-methylcyclohexa-1,5-dien-1-amine;molecular hydrogen (PubChem CID 142083618) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 2-methanimidoyl-5-methylcyclohexa-1,5-dien-1-amine;molecular hydrogen.
| Compound Name | 2-methanimidoyl-5-methylcyclohexa-1,5-dien-1-amine;molecular hydrogen |
|---|---|
| PubChem CID | 142083618 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 2-methanimidoyl-5-methylcyclohexa-1,5-dien-1-amine;molecular hydrogen |
| SMILES | [H]/N=C/C1=C(N)C=C(C)CC1.[H][H] |
| InChI | InChI=1S/C8H12N2.H2/c1-6-2-3-7(5-9)8(10)4-6;/h4-5,9H,2-3,10H2,1H3;1H/b9-5+; |
| InChIKey | ZNIPGYDMTBHUPC-SZKNIZGXSA-N |
| XLogP | 1.83 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|