C8H11FN2 — CID 172601501
6-Fluoro-2-(methyliminomethyl)cyclohexa-1,5-dien-1-amine (PubChem CID 172601501) has the molecular formula C8H11FN2 and a molecular weight of 154.18 g/mol. Its IUPAC name is 6-fluoro-2-(methyliminomethyl)cyclohexa-1,5-dien-1-amine.
| Compound Name | 6-Fluoro-2-(methyliminomethyl)cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 172601501 |
| Molecular Formula | C8H11FN2 |
| Molecular Weight | 154.18 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 6-fluoro-2-(methyliminomethyl)cyclohexa-1,5-dien-1-amine |
| SMILES | CN=CC1=C(C(=CCC1)F)N |
| InChI | InChI=1S/C8H11FN2/c1-11-5-6-3-2-4-7(9)8(6)10/h4-5H,2-3,10H2,1H3 |
| InChIKey | CLMXAJXRAGIHIN-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 38.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | 238 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.18 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|