C9H11FN2 — CID 123974610
4,5-di(ethylidene)-3-fluoropyridin-2-amine (PubChem CID 123974610) has the molecular formula C9H11FN2 and a molecular weight of 166.20 g/mol. Its IUPAC name is 4,5-di(ethylidene)-3-fluoropyridin-2-amine.
| Compound Name | 4,5-di(ethylidene)-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 123974610 |
| Molecular Formula | C9H11FN2 |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 4,5-di(ethylidene)-3-fluoropyridin-2-amine |
| SMILES | CC=c1cnc(N)c(F)c1=CC |
| InChI | InChI=1S/C9H11FN2/c1-3-6-5-12-9(11)8(10)7(6)4-2/h3-5H,11H2,1-2H3 |
| InChIKey | LXKWZOJMWWBHRE-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |