C9H13F3N2 — CID 174086267
(1Z,3E)-3-ethyl-1-(ethylideneamino)-5,5,5-trifluoropenta-1,3-dien-1-amine (PubChem CID 174086267) has the molecular formula C9H13F3N2 and a molecular weight of 206.21 g/mol. Its IUPAC name is (1Z,3E)-3-ethyl-1-(ethylideneamino)-5,5,5-trifluoropenta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-3-ethyl-1-(ethylideneamino)-5,5,5-trifluoropenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 174086267 |
| Molecular Formula | C9H13F3N2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | (1Z,3E)-3-ethyl-1-(ethylideneamino)-5,5,5-trifluoropenta-1,3-dien-1-amine |
| SMILES | CC=N/C(N)=C\C(=C\C(F)(F)F)CC |
| InChI | InChI=1S/C9H13F3N2/c1-3-7(6-9(10,11)12)5-8(13)14-4-2/h4-6H,3,13H2,1-2H3/b7-6+,8-5-,14-4? |
| InChIKey | DYAXNCDLBFCWPD-GCTNUAOSSA-N |
| XLogP | 2.78 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|