About benzene;5-methyl-3H-pyridin-3-id-6-amine;yttrium
benzene;5-methyl-3H-pyridin-3-id-6-amine;yttrium (PubChem CID 59190356) has the molecular formula C12H12N2Y-2
and a molecular weight of 273.15 g/mol. Its IUPAC name is benzene;5-methyl-3H-pyridin-3-id-6-amine;yttrium.
Molecular Properties
| Compound Name | benzene;5-methyl-3H-pyridin-3-id-6-amine;yttrium |
| PubChem CID | 59190356 |
| Molecular Formula | C12H12N2Y-2 |
| Molecular Weight | 273.15 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | benzene;5-methyl-3H-pyridin-3-id-6-amine;yttrium |
| SMILES | Cc1c[c-]cnc1N.[Y].[c-]1ccccc1 |
| InChI | InChI=1S/C6H7N2.C6H5.Y/c1-5-3-2-4-8-6(5)7;1-2-4-6-5-3-1;/h3-4H,1H3,(H2,7,8);1-5H;/q2*-1; |
| InChIKey | CMYNLNOXSAZKSN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.15 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze benzene;5-methyl-3H-pyridin-3-id-6-amine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;5-methyl-3H-pyridin-3-id-6-amine;yttrium?
The IUPAC name of benzene;5-methyl-3H-pyridin-3-id-6-amine;yttrium (CID 59190356) is benzene;5-methyl-3H-pyridin-3-id-6-amine;yttrium.
What is the SMILES notation for benzene;5-methyl-3H-pyridin-3-id-6-amine;yttrium?
The canonical SMILES for benzene;5-methyl-3H-pyridin-3-id-6-amine;yttrium is Cc1c[c-]cnc1N.[Y].[c-]1ccccc1.
What is the InChIKey of benzene;5-methyl-3H-pyridin-3-id-6-amine;yttrium?
The InChIKey is CMYNLNOXSAZKSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N2.C6H5.Y/c1-5-3-2-4-8-6(5)7;1-2-4-6-5-3-1;/h3-4H,1H3,(H2,7,8);1-5H;/q2*-1;.
What are the key properties of benzene;5-methyl-3H-pyridin-3-id-6-amine;yttrium?
benzene;5-methyl-3H-pyridin-3-id-6-amine;yttrium has a molecular weight of 273.15 g/mol, XLogP of 2.26, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;5-methyl-3H-pyridin-3-id-6-amine;yttrium is sourced from PubChem (CID 59190356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).