C12H14F3N3 — CID 162592923
4-imino-1-[[5-methyl-3-(trifluoromethyl)cyclohexa-2,4-dien-1-ylidene]amino]but-2-en-2-amine (PubChem CID 162592923) has the molecular formula C12H14F3N3 and a molecular weight of 257.26 g/mol. Its IUPAC name is 4-imino-1-[[5-methyl-3-(trifluoromethyl)cyclohexa-2,4-dien-1-ylidene]amino]but-2-en-2-amine.
| Compound Name | 4-imino-1-[[5-methyl-3-(trifluoromethyl)cyclohexa-2,4-dien-1-ylidene]amino]but-2-en-2-amine |
|---|---|
| PubChem CID | 162592923 |
| Molecular Formula | C12H14F3N3 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 4-imino-1-[[5-methyl-3-(trifluoromethyl)cyclohexa-2,4-dien-1-ylidene]amino]but-2-en-2-amine |
| SMILES | [H]/N=C/C=C(N)C/N=C1/C=C(C(F)(F)F)C=C(C)C1 |
| InChI | InChI=1S/C12H14F3N3/c1-8-4-9(12(13,14)15)6-11(5-8)18-7-10(17)2-3-16/h2-4,6,16H,5,7,17H2,1H3/b10-2?,16-3+,18-11+ |
| InChIKey | ABJKKWLJBDEIQY-FIMOPISNSA-N |
| XLogP | 2.76 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|