C32H52O2 — CID 146438837
5,7,8-triethyl-2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4,6,7-tetrahydrochromen-6-ol (PubChem CID 146438837) has the molecular formula C32H52O2 and a molecular weight of 468.77 g/mol. Its IUPAC name is 5,7,8-triethyl-2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4,6,7-tetrahydrochromen-6-ol.
| Compound Name | 5,7,8-triethyl-2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4,6,7-tetrahydrochromen-6-ol |
|---|---|
| PubChem CID | 146438837 |
| Molecular Formula | C32H52O2 |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.40 |
| IUPAC Name | 5,7,8-triethyl-2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4,6,7-tetrahydrochromen-6-ol |
| SMILES | CCC1=C2CCC(C)(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)OC2=C(CC)C(CC)C1O |
| InChI | InChI=1S/C32H52O2/c1-9-26-28(11-3)31-29(27(10-2)30(26)33)20-22-32(8,34-31)21-14-19-25(7)18-13-17-24(6)16-12-15-23(4)5/h15,17,19,26,30,33H,9-14,16,18,20-22H2,1-8H3/b24-17+,25-19+ |
| InChIKey | XOXQUDXHCVTSGS-OCQYTUGVSA-N |
| XLogP | 9.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|