C24H27FN4OS — CID 146439271
6-fluoro-N-[[5-methyl-6-[1-(1-phenylethyl)piperidin-4-yl]oxy-3-pyridinyl]sulfanyl]pyridin-2-amine (PubChem CID 146439271) has the molecular formula C24H27FN4OS and a molecular weight of 438.57 g/mol. Its IUPAC name is 6-fluoro-N-[[5-methyl-6-[1-(1-phenylethyl)piperidin-4-yl]oxy-3-pyridinyl]sulfanyl]pyridin-2-amine.
| Compound Name | 6-fluoro-N-[[5-methyl-6-[1-(1-phenylethyl)piperidin-4-yl]oxy-3-pyridinyl]sulfanyl]pyridin-2-amine |
|---|---|
| PubChem CID | 146439271 |
| Molecular Formula | C24H27FN4OS |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 6-fluoro-N-[[5-methyl-6-[1-(1-phenylethyl)piperidin-4-yl]oxy-3-pyridinyl]sulfanyl]pyridin-2-amine |
| SMILES | Cc1cc(SNc2cccc(F)n2)cnc1OC1CCN(C(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H27FN4OS/c1-17-15-21(31-28-23-10-6-9-22(25)27-23)16-26-24(17)30-20-11-13-29(14-12-20)18(2)19-7-4-3-5-8-19/h3-10,15-16,18,20H,11-14H2,1-2H3,(H,27,28) |
| InChIKey | URYNZNCFKDFKQY-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|