C23H29N5S2 — CID 146439293
N-[[4-methyl-5-[methyl-[1-(1-phenylethyl)piperidin-4-yl]amino]-2-pyridinyl]sulfanyl]-1,3-thiazol-4-amine (PubChem CID 146439293) has the molecular formula C23H29N5S2 and a molecular weight of 439.65 g/mol. Its IUPAC name is N-[[4-methyl-5-[methyl-[1-(1-phenylethyl)piperidin-4-yl]amino]-2-pyridinyl]sulfanyl]-1,3-thiazol-4-amine.
| Compound Name | N-[[4-methyl-5-[methyl-[1-(1-phenylethyl)piperidin-4-yl]amino]-2-pyridinyl]sulfanyl]-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 146439293 |
| Molecular Formula | C23H29N5S2 |
| Molecular Weight | 439.65 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[[4-methyl-5-[methyl-[1-(1-phenylethyl)piperidin-4-yl]amino]-2-pyridinyl]sulfanyl]-1,3-thiazol-4-amine |
| SMILES | Cc1cc(SNc2cscn2)ncc1N(C)C1CCN(C(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H29N5S2/c1-17-13-23(30-26-22-15-29-16-25-22)24-14-21(17)27(3)20-9-11-28(12-10-20)18(2)19-7-5-4-6-8-19/h4-8,13-16,18,20,26H,9-12H2,1-3H3 |
| InChIKey | UKESFVASEIOEFC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.65 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|