C21H30N4O — CID 14644020
4-(2-methylpentan-3-yloxy)-2-(4-prop-2-enylpiperazin-1-yl)quinazoline (PubChem CID 14644020) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 4-(2-methylpentan-3-yloxy)-2-(4-prop-2-enylpiperazin-1-yl)quinazoline.
| Compound Name | 4-(2-methylpentan-3-yloxy)-2-(4-prop-2-enylpiperazin-1-yl)quinazoline |
|---|---|
| PubChem CID | 14644020 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 4-(2-methylpentan-3-yloxy)-2-(4-prop-2-enylpiperazin-1-yl)quinazoline |
| SMILES | C=CCN1CCN(c2nc(OC(CC)C(C)C)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C21H30N4O/c1-5-11-24-12-14-25(15-13-24)21-22-18-10-8-7-9-17(18)20(23-21)26-19(6-2)16(3)4/h5,7-10,16,19H,1,6,11-15H2,2-4H3 |
| InChIKey | WQRBOBDGHXYMFU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|