C26H30N6OS — CID 146442895
7-[(2R,6S)-2-methyl-6-[(5-piperazin-1-yl-1,3-dihydroisoindol-2-yl)methyl]morpholin-4-yl]-1,3-benzothiazole-4-carbonitrile (PubChem CID 146442895) has the molecular formula C26H30N6OS and a molecular weight of 474.63 g/mol. Its IUPAC name is 7-[(2R,6S)-2-methyl-6-[(5-piperazin-1-yl-1,3-dihydroisoindol-2-yl)methyl]morpholin-4-yl]-1,3-benzothiazole-4-carbonitrile.
| Compound Name | 7-[(2R,6S)-2-methyl-6-[(5-piperazin-1-yl-1,3-dihydroisoindol-2-yl)methyl]morpholin-4-yl]-1,3-benzothiazole-4-carbonitrile |
|---|---|
| PubChem CID | 146442895 |
| Molecular Formula | C26H30N6OS |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 7-[(2R,6S)-2-methyl-6-[(5-piperazin-1-yl-1,3-dihydroisoindol-2-yl)methyl]morpholin-4-yl]-1,3-benzothiazole-4-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncsc23)C[C@H](CN2Cc3ccc(N4CCNCC4)cc3C2)O1 |
| InChI | InChI=1S/C26H30N6OS/c1-18-12-32(24-5-3-19(11-27)25-26(24)34-17-29-25)16-23(33-18)15-30-13-20-2-4-22(10-21(20)14-30)31-8-6-28-7-9-31/h2-5,10,17-18,23,28H,6-9,12-16H2,1H3/t18-,23+/m1/s1 |
| InChIKey | CORVFMLKZZWGIC-JPYJTQIMSA-N |
| XLogP | 3.19 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|