C30H33BN6O2 — CID 174032573
CID 174032573 (PubChem CID 174032573) has the molecular formula C30H33BN6O2 and a molecular weight of 520.45 g/mol.
| Compound Name | CID 174032573 |
|---|---|
| PubChem CID | 174032573 |
| Molecular Formula | C30H33BN6O2 |
| Molecular Weight | 520.45 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(N3C[C@H](CN4CC5(C4)OCc4cc(N6CCNCC6)ccc45)O[C@H](C)C3)ccc(C#N)c2n1 |
| InChI | InChI=1S/C30H33BN6O2/c1-20-14-37(27-6-2-21(13-32)29-25(27)4-7-28(31)34-29)16-24(39-20)15-35-18-30(19-35)26-5-3-23(12-22(26)17-38-30)36-10-8-33-9-11-36/h2-7,12,20,24,33H,8-11,14-19H2,1H3/t20-,24+/m1/s1 |
| InChIKey | DIJYBQOEQCCTSF-YKSBVNFPSA-N |
| XLogP | 1.64 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|