C30H33BN6O2 — CID 174032599
CID 174032599 (PubChem CID 174032599) has the molecular formula C30H33BN6O2 and a molecular weight of 520.45 g/mol.
| Compound Name | CID 174032599 |
|---|---|
| PubChem CID | 174032599 |
| Molecular Formula | C30H33BN6O2 |
| Molecular Weight | 520.45 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(N3C[C@H](CN4CC5(C4)OCc4cc(N6CC(C)(N)C6)ccc45)O[C@H](C)C3)ccc(C#N)c2n1 |
| InChI | InChI=1S/C30H33BN6O2/c1-19-11-36(26-7-3-20(10-32)28-24(26)5-8-27(31)34-28)13-23(39-19)12-35-17-30(18-35)25-6-4-22(9-21(25)14-38-30)37-15-29(2,33)16-37/h3-9,19,23H,11-18,33H2,1-2H3/t19-,23+/m1/s1 |
| InChIKey | PHJPWHMAMICFCI-XXBNENTESA-N |
| XLogP | 1.77 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.45 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|