C21H18ClN5O2 — CID 146449241
N'-acetyl-5-(2-chlorophenyl)-2-cyclopropyl-N'-pyridin-2-ylpyrimidine-4-carbohydrazide (PubChem CID 146449241) has the molecular formula C21H18ClN5O2 and a molecular weight of 407.86 g/mol. Its IUPAC name is N'-acetyl-5-(2-chlorophenyl)-2-cyclopropyl-N'-pyridin-2-ylpyrimidine-4-carbohydrazide.
| Compound Name | N'-acetyl-5-(2-chlorophenyl)-2-cyclopropyl-N'-pyridin-2-ylpyrimidine-4-carbohydrazide |
|---|---|
| PubChem CID | 146449241 |
| Molecular Formula | C21H18ClN5O2 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N'-acetyl-5-(2-chlorophenyl)-2-cyclopropyl-N'-pyridin-2-ylpyrimidine-4-carbohydrazide |
| SMILES | CC(=O)N(NC(=O)c1nc(C2CC2)ncc1-c1ccccc1Cl)c1ccccn1 |
| InChI | InChI=1S/C21H18ClN5O2/c1-13(28)27(18-8-4-5-11-23-18)26-21(29)19-16(15-6-2-3-7-17(15)22)12-24-20(25-19)14-9-10-14/h2-8,11-12,14H,9-10H2,1H3,(H,26,29) |
| InChIKey | RZEJLTHHNFXSDQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|