C16H12ClN3S — CID 170992532
4-[5-(2-chlorophenyl)-2-cyclopropylpyrimidin-4-yl]-1,3-thiazole (PubChem CID 170992532) has the molecular formula C16H12ClN3S and a molecular weight of 313.81 g/mol. Its IUPAC name is 4-[5-(2-chlorophenyl)-2-cyclopropylpyrimidin-4-yl]-1,3-thiazole.
| Compound Name | 4-[5-(2-chlorophenyl)-2-cyclopropylpyrimidin-4-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 170992532 |
| Molecular Formula | C16H12ClN3S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 4-[5-(2-chlorophenyl)-2-cyclopropylpyrimidin-4-yl]-1,3-thiazole |
| SMILES | Clc1ccccc1-c1cnc(C2CC2)nc1-c1cscn1 |
| InChI | InChI=1S/C16H12ClN3S/c17-13-4-2-1-3-11(13)12-7-18-16(10-5-6-10)20-15(12)14-8-21-9-19-14/h1-4,7-10H,5-6H2 |
| InChIKey | OFSBQJQFLGYWPV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |