C19H19F2NO2 — CID 146451240
1-(2,3-difluoro-4-phenylmethoxyphenyl)-3-ethylpyrrolidin-2-one (PubChem CID 146451240) has the molecular formula C19H19F2NO2 and a molecular weight of 331.36 g/mol. Its IUPAC name is 1-(2,3-difluoro-4-phenylmethoxyphenyl)-3-ethylpyrrolidin-2-one.
| Compound Name | 1-(2,3-difluoro-4-phenylmethoxyphenyl)-3-ethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 146451240 |
| Molecular Formula | C19H19F2NO2 |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-(2,3-difluoro-4-phenylmethoxyphenyl)-3-ethylpyrrolidin-2-one |
| SMILES | CCC1CCN(c2ccc(OCc3ccccc3)c(F)c2F)C1=O |
| InChI | InChI=1S/C19H19F2NO2/c1-2-14-10-11-22(19(14)23)15-8-9-16(18(21)17(15)20)24-12-13-6-4-3-5-7-13/h3-9,14H,2,10-12H2,1H3 |
| InChIKey | YADDNKBQFOOBHT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |