C22H24N2O4 — CID 146451279
5-(benzhydrylideneamino)-3-methoxycarbonyl-3-methylpiperidine-1-carboxylic acid (PubChem CID 146451279) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 5-(benzhydrylideneamino)-3-methoxycarbonyl-3-methylpiperidine-1-carboxylic acid.
| Compound Name | 5-(benzhydrylideneamino)-3-methoxycarbonyl-3-methylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 146451279 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 5-(benzhydrylideneamino)-3-methoxycarbonyl-3-methylpiperidine-1-carboxylic acid |
| SMILES | COC(=O)C1(C)CC(N=C(c2ccccc2)c2ccccc2)CN(C(=O)O)C1 |
| InChI | InChI=1S/C22H24N2O4/c1-22(20(25)28-2)13-18(14-24(15-22)21(26)27)23-19(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,18H,13-15H2,1-2H3,(H,26,27) |
| InChIKey | GDCMNPDULWNXLM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|