C20H20N4O6 — CID 146451370
bis[(4-aminophenyl)carbamoyl] cyclobutane-1,3-dicarboxylate (PubChem CID 146451370) has the molecular formula C20H20N4O6 and a molecular weight of 412.40 g/mol. Its IUPAC name is bis[(4-aminophenyl)carbamoyl] cyclobutane-1,3-dicarboxylate.
| Compound Name | bis[(4-aminophenyl)carbamoyl] cyclobutane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 146451370 |
| Molecular Formula | C20H20N4O6 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | bis[(4-aminophenyl)carbamoyl] cyclobutane-1,3-dicarboxylate |
| SMILES | Nc1ccc(NC(=O)OC(=O)C2CC(C(=O)OC(=O)Nc3ccc(N)cc3)C2)cc1 |
| InChI | InChI=1S/C20H20N4O6/c21-13-1-5-15(6-2-13)23-19(27)29-17(25)11-9-12(10-11)18(26)30-20(28)24-16-7-3-14(22)4-8-16/h1-8,11-12H,9-10,21-22H2,(H,23,27)(H,24,28) |
| InChIKey | GDLOCKINZRBBKQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 162.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|