C22H25BrFN3O — CID 146455945
3-(bromomethyl)-N-[(S)-cyclopropyl-(5-fluoro-4-methyl-2-pyridinyl)methyl]-5-pyrrolidin-1-ylbenzamide (PubChem CID 146455945) has the molecular formula C22H25BrFN3O and a molecular weight of 446.36 g/mol. Its IUPAC name is 3-(bromomethyl)-N-[(S)-cyclopropyl-(5-fluoro-4-methyl-2-pyridinyl)methyl]-5-pyrrolidin-1-ylbenzamide.
| Compound Name | 3-(bromomethyl)-N-[(S)-cyclopropyl-(5-fluoro-4-methyl-2-pyridinyl)methyl]-5-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 146455945 |
| Molecular Formula | C22H25BrFN3O |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 3-(bromomethyl)-N-[(S)-cyclopropyl-(5-fluoro-4-methyl-2-pyridinyl)methyl]-5-pyrrolidin-1-ylbenzamide |
| SMILES | Cc1cc([C@@H](NC(=O)c2cc(CBr)cc(N3CCCC3)c2)C2CC2)ncc1F |
| InChI | InChI=1S/C22H25BrFN3O/c1-14-8-20(25-13-19(14)24)21(16-4-5-16)26-22(28)17-9-15(12-23)10-18(11-17)27-6-2-3-7-27/h8-11,13,16,21H,2-7,12H2,1H3,(H,26,28)/t21-/m0/s1 |
| InChIKey | XBYPBFQYIDWJDH-NRFANRHFSA-N |
| XLogP | 4.91 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|