C23H26BrFN2O — CID 146457150
3-(bromomethyl)-N-[(S)-cyclopropyl-(4-fluoro-3-methylphenyl)methyl]-5-pyrrolidin-1-ylbenzamide (PubChem CID 146457150) has the molecular formula C23H26BrFN2O and a molecular weight of 445.38 g/mol. Its IUPAC name is 3-(bromomethyl)-N-[(S)-cyclopropyl-(4-fluoro-3-methylphenyl)methyl]-5-pyrrolidin-1-ylbenzamide.
| Compound Name | 3-(bromomethyl)-N-[(S)-cyclopropyl-(4-fluoro-3-methylphenyl)methyl]-5-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 146457150 |
| Molecular Formula | C23H26BrFN2O |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 3-(bromomethyl)-N-[(S)-cyclopropyl-(4-fluoro-3-methylphenyl)methyl]-5-pyrrolidin-1-ylbenzamide |
| SMILES | Cc1cc([C@@H](NC(=O)c2cc(CBr)cc(N3CCCC3)c2)C2CC2)ccc1F |
| InChI | InChI=1S/C23H26BrFN2O/c1-15-10-18(6-7-21(15)25)22(17-4-5-17)26-23(28)19-11-16(14-24)12-20(13-19)27-8-2-3-9-27/h6-7,10-13,17,22H,2-5,8-9,14H2,1H3,(H,26,28)/t22-/m0/s1 |
| InChIKey | DERIWJQKXAGMPJ-QFIPXVFZSA-N |
| XLogP | 5.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|