C25H23BrF2N2O — CID 146456227
3-(bromomethyl)-N-[cyclopropyl-(5-fluoro-6-methyl-2-pyridinyl)methyl]-5-(4-fluoro-2-methylphenyl)benzamide (PubChem CID 146456227) has the molecular formula C25H23BrF2N2O and a molecular weight of 485.37 g/mol. Its IUPAC name is 3-(bromomethyl)-N-[cyclopropyl-(5-fluoro-6-methyl-2-pyridinyl)methyl]-5-(4-fluoro-2-methylphenyl)benzamide.
| Compound Name | 3-(bromomethyl)-N-[cyclopropyl-(5-fluoro-6-methyl-2-pyridinyl)methyl]-5-(4-fluoro-2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 146456227 |
| Molecular Formula | C25H23BrF2N2O |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 3-(bromomethyl)-N-[cyclopropyl-(5-fluoro-6-methyl-2-pyridinyl)methyl]-5-(4-fluoro-2-methylphenyl)benzamide |
| SMILES | Cc1cc(F)ccc1-c1cc(CBr)cc(C(=O)NC(c2ccc(F)c(C)n2)C2CC2)c1 |
| InChI | InChI=1S/C25H23BrF2N2O/c1-14-9-20(27)5-6-21(14)18-10-16(13-26)11-19(12-18)25(31)30-24(17-3-4-17)23-8-7-22(28)15(2)29-23/h5-12,17,24H,3-4,13H2,1-2H3,(H,30,31) |
| InChIKey | CANQNXMWWWQWSF-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|