C24H18BrCl2F2NO — CID 146456574
3-(bromomethyl)-5-(2-chloro-4-fluorophenyl)-N-[(4-chloro-3-fluorophenyl)-cyclopropylmethyl]benzamide (PubChem CID 146456574) has the molecular formula C24H18BrCl2F2NO and a molecular weight of 525.22 g/mol. Its IUPAC name is 3-(bromomethyl)-5-(2-chloro-4-fluorophenyl)-N-[(4-chloro-3-fluorophenyl)-cyclopropylmethyl]benzamide.
| Compound Name | 3-(bromomethyl)-5-(2-chloro-4-fluorophenyl)-N-[(4-chloro-3-fluorophenyl)-cyclopropylmethyl]benzamide |
|---|---|
| PubChem CID | 146456574 |
| Molecular Formula | C24H18BrCl2F2NO |
| Molecular Weight | 525.22 g/mol |
| Exact Mass | 522.99 |
| IUPAC Name | 3-(bromomethyl)-5-(2-chloro-4-fluorophenyl)-N-[(4-chloro-3-fluorophenyl)-cyclopropylmethyl]benzamide |
| SMILES | O=C(NC(c1ccc(Cl)c(F)c1)C1CC1)c1cc(CBr)cc(-c2ccc(F)cc2Cl)c1 |
| InChI | InChI=1S/C24H18BrCl2F2NO/c25-12-13-7-16(19-5-4-18(28)11-21(19)27)9-17(8-13)24(31)30-23(14-1-2-14)15-3-6-20(26)22(29)10-15/h3-11,14,23H,1-2,12H2,(H,30,31) |
| InChIKey | ZPLOXWQBKXMBGE-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.22 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|