C11H13N3OS2 — CID 146460550
4-(4-methylsulfanylthieno[3,2-d]pyrimidin-7-yl)morpholine (PubChem CID 146460550) has the molecular formula C11H13N3OS2 and a molecular weight of 267.38 g/mol. Its IUPAC name is 4-(4-methylsulfanylthieno[3,2-d]pyrimidin-7-yl)morpholine.
| Compound Name | 4-(4-methylsulfanylthieno[3,2-d]pyrimidin-7-yl)morpholine |
|---|---|
| PubChem CID | 146460550 |
| Molecular Formula | C11H13N3OS2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 4-(4-methylsulfanylthieno[3,2-d]pyrimidin-7-yl)morpholine |
| SMILES | CSc1ncnc2c(N3CCOCC3)csc12 |
| InChI | InChI=1S/C11H13N3OS2/c1-16-11-10-9(12-7-13-11)8(6-17-10)14-2-4-15-5-3-14/h6-7H,2-5H2,1H3 |
| InChIKey | GHBIALXHCGOHPY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |