C11H13N3O3S2 — CID 156772502
4-(4-methylsulfonylthieno[3,2-d]pyrimidin-7-yl)morpholine (PubChem CID 156772502) has the molecular formula C11H13N3O3S2 and a molecular weight of 299.38 g/mol. Its IUPAC name is 4-(4-methylsulfonylthieno[3,2-d]pyrimidin-7-yl)morpholine.
| Compound Name | 4-(4-methylsulfonylthieno[3,2-d]pyrimidin-7-yl)morpholine |
|---|---|
| PubChem CID | 156772502 |
| Molecular Formula | C11H13N3O3S2 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 4-(4-methylsulfonylthieno[3,2-d]pyrimidin-7-yl)morpholine |
| SMILES | CS(=O)(=O)c1ncnc2c(N3CCOCC3)csc12 |
| InChI | InChI=1S/C11H13N3O3S2/c1-19(15,16)11-10-9(12-7-13-11)8(6-18-10)14-2-4-17-5-3-14/h6-7H,2-5H2,1H3 |
| InChIKey | ZTRJIYLQMPDBJC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |