C16H23NO3S — CID 142505811
ethane;5-morpholin-4-yl-3-propan-2-ylthieno[3,2-b]pyran-7-one (PubChem CID 142505811) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is ethane;5-morpholin-4-yl-3-propan-2-ylthieno[3,2-b]pyran-7-one.
| Compound Name | ethane;5-morpholin-4-yl-3-propan-2-ylthieno[3,2-b]pyran-7-one |
|---|---|
| PubChem CID | 142505811 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | ethane;5-morpholin-4-yl-3-propan-2-ylthieno[3,2-b]pyran-7-one |
| SMILES | CC.CC(C)c1csc2c(=O)cc(N3CCOCC3)oc12 |
| InChI | InChI=1S/C14H17NO3S.C2H6/c1-9(2)10-8-19-14-11(16)7-12(18-13(10)14)15-3-5-17-6-4-15;1-2/h7-9H,3-6H2,1-2H3;1-2H3 |
| InChIKey | KCZISYGMGIPUNO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |