C19H21NO3S — CID 143839150
ethane;5-morpholin-4-yl-3-phenylthieno[3,2-b]pyran-7-one (PubChem CID 143839150) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is ethane;5-morpholin-4-yl-3-phenylthieno[3,2-b]pyran-7-one.
| Compound Name | ethane;5-morpholin-4-yl-3-phenylthieno[3,2-b]pyran-7-one |
|---|---|
| PubChem CID | 143839150 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | ethane;5-morpholin-4-yl-3-phenylthieno[3,2-b]pyran-7-one |
| SMILES | CC.O=c1cc(N2CCOCC2)oc2c(-c3ccccc3)csc12 |
| InChI | InChI=1S/C17H15NO3S.C2H6/c19-14-10-15(18-6-8-20-9-7-18)21-16-13(11-22-17(14)16)12-4-2-1-3-5-12;1-2/h1-5,10-11H,6-9H2;1-2H3 |
| InChIKey | BUXXKUPSDWUVJB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |