C22H25NO4S — CID 142505751
ethane;5-morpholin-4-yl-3-(3-propanoylphenyl)thieno[3,2-b]pyran-7-one (PubChem CID 142505751) has the molecular formula C22H25NO4S and a molecular weight of 399.51 g/mol. Its IUPAC name is ethane;5-morpholin-4-yl-3-(3-propanoylphenyl)thieno[3,2-b]pyran-7-one.
| Compound Name | ethane;5-morpholin-4-yl-3-(3-propanoylphenyl)thieno[3,2-b]pyran-7-one |
|---|---|
| PubChem CID | 142505751 |
| Molecular Formula | C22H25NO4S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | ethane;5-morpholin-4-yl-3-(3-propanoylphenyl)thieno[3,2-b]pyran-7-one |
| SMILES | CC.CCC(=O)c1cccc(-c2csc3c(=O)cc(N4CCOCC4)oc23)c1 |
| InChI | InChI=1S/C20H19NO4S.C2H6/c1-2-16(22)14-5-3-4-13(10-14)15-12-26-20-17(23)11-18(25-19(15)20)21-6-8-24-9-7-21;1-2/h3-5,10-12H,2,6-9H2,1H3;1-2H3 |
| InChIKey | RJNIQXRMCPQLDI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |