C24H25NO4S — CID 157029185
5-morpholin-4-yl-3-[4-(5-oxohept-6-enyl)phenyl]thieno[3,2-b]pyran-7-one (PubChem CID 157029185) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is 5-morpholin-4-yl-3-[4-(5-oxohept-6-enyl)phenyl]thieno[3,2-b]pyran-7-one.
| Compound Name | 5-morpholin-4-yl-3-[4-(5-oxohept-6-enyl)phenyl]thieno[3,2-b]pyran-7-one |
|---|---|
| PubChem CID | 157029185 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 5-morpholin-4-yl-3-[4-(5-oxohept-6-enyl)phenyl]thieno[3,2-b]pyran-7-one |
| SMILES | C=CC(=O)CCCCc1ccc(-c2csc3c(=O)cc(N4CCOCC4)oc23)cc1 |
| InChI | InChI=1S/C24H25NO4S/c1-2-19(26)6-4-3-5-17-7-9-18(10-8-17)20-16-30-24-21(27)15-22(29-23(20)24)25-11-13-28-14-12-25/h2,7-10,15-16H,1,3-6,11-14H2 |
| InChIKey | YLRKQFPQZQSTRI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|