C30H32N2O3S — CID 142505768
3-[4-[(2E,3Z)-3-ethenyl-2-(2-methylbutylidene)hexa-3,5-dienimidoyl]phenyl]-5-morpholin-4-ylthieno[3,2-b]pyran-7-one (PubChem CID 142505768) has the molecular formula C30H32N2O3S and a molecular weight of 500.66 g/mol. Its IUPAC name is 3-[4-[(2E,3Z)-3-ethenyl-2-(2-methylbutylidene)hexa-3,5-dienimidoyl]phenyl]-5-morpholin-4-ylthieno[3,2-b]pyran-7-one.
| Compound Name | 3-[4-[(2E,3Z)-3-ethenyl-2-(2-methylbutylidene)hexa-3,5-dienimidoyl]phenyl]-5-morpholin-4-ylthieno[3,2-b]pyran-7-one |
|---|---|
| PubChem CID | 142505768 |
| Molecular Formula | C30H32N2O3S |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 3-[4-[(2E,3Z)-3-ethenyl-2-(2-methylbutylidene)hexa-3,5-dienimidoyl]phenyl]-5-morpholin-4-ylthieno[3,2-b]pyran-7-one |
| SMILES | [H]/N=C(C(=C\C(C)CC)\C(C=C)=C/C=C)/c1ccc(-c2csc3c(=O)cc(N4CCOCC4)oc23)cc1 |
| InChI | InChI=1S/C30H32N2O3S/c1-5-8-21(7-3)24(17-20(4)6-2)28(31)23-11-9-22(10-12-23)25-19-36-30-26(33)18-27(35-29(25)30)32-13-15-34-16-14-32/h5,7-12,17-20,31H,1,3,6,13-16H2,2,4H3/b21-8-,24-17+,31-28- |
| InChIKey | BDKHAXLUWXAEKG-TYWOIPMZSA-N |
| XLogP | 7.00 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|