C24H23N3O4S — CID 146319968
3-(4-but-2-ynoyl-1-methyl-2,3-dihydroquinoxalin-6-yl)-5-morpholin-4-ylthieno[3,2-b]pyran-7-one (PubChem CID 146319968) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is 3-(4-but-2-ynoyl-1-methyl-2,3-dihydroquinoxalin-6-yl)-5-morpholin-4-ylthieno[3,2-b]pyran-7-one.
| Compound Name | 3-(4-but-2-ynoyl-1-methyl-2,3-dihydroquinoxalin-6-yl)-5-morpholin-4-ylthieno[3,2-b]pyran-7-one |
|---|---|
| PubChem CID | 146319968 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 3-(4-but-2-ynoyl-1-methyl-2,3-dihydroquinoxalin-6-yl)-5-morpholin-4-ylthieno[3,2-b]pyran-7-one |
| SMILES | CC#CC(=O)N1CCN(C)c2ccc(-c3csc4c(=O)cc(N5CCOCC5)oc34)cc21 |
| InChI | InChI=1S/C24H23N3O4S/c1-3-4-21(29)27-8-7-25(2)18-6-5-16(13-19(18)27)17-15-32-24-20(28)14-22(31-23(17)24)26-9-11-30-12-10-26/h5-6,13-15H,7-12H2,1-2H3 |
| InChIKey | IAENFVJPUKMPCC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|