C21H17FN2O4S — CID 146319971
N-[4-fluoro-3-(5-morpholin-4-yl-7-oxothieno[3,2-b]pyran-3-yl)phenyl]but-2-ynamide (PubChem CID 146319971) has the molecular formula C21H17FN2O4S and a molecular weight of 412.44 g/mol. Its IUPAC name is N-[4-fluoro-3-(5-morpholin-4-yl-7-oxothieno[3,2-b]pyran-3-yl)phenyl]but-2-ynamide.
| Compound Name | N-[4-fluoro-3-(5-morpholin-4-yl-7-oxothieno[3,2-b]pyran-3-yl)phenyl]but-2-ynamide |
|---|---|
| PubChem CID | 146319971 |
| Molecular Formula | C21H17FN2O4S |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | N-[4-fluoro-3-(5-morpholin-4-yl-7-oxothieno[3,2-b]pyran-3-yl)phenyl]but-2-ynamide |
| SMILES | CC#CC(=O)Nc1ccc(F)c(-c2csc3c(=O)cc(N4CCOCC4)oc23)c1 |
| InChI | InChI=1S/C21H17FN2O4S/c1-2-3-18(26)23-13-4-5-16(22)14(10-13)15-12-29-21-17(25)11-19(28-20(15)21)24-6-8-27-9-7-24/h4-5,10-12H,6-9H2,1H3,(H,23,26) |
| InChIKey | FTDMHMZORJTPCY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|