C21H20N2O6S — CID 146310484
N-hydroxy-N-[4-methoxy-3-(5-morpholin-4-yl-7-oxothieno[3,2-b]pyran-3-yl)phenyl]prop-2-enamide (PubChem CID 146310484) has the molecular formula C21H20N2O6S and a molecular weight of 428.47 g/mol. Its IUPAC name is N-hydroxy-N-[4-methoxy-3-(5-morpholin-4-yl-7-oxothieno[3,2-b]pyran-3-yl)phenyl]prop-2-enamide.
| Compound Name | N-hydroxy-N-[4-methoxy-3-(5-morpholin-4-yl-7-oxothieno[3,2-b]pyran-3-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146310484 |
| Molecular Formula | C21H20N2O6S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N-hydroxy-N-[4-methoxy-3-(5-morpholin-4-yl-7-oxothieno[3,2-b]pyran-3-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)N(O)c1ccc(OC)c(-c2csc3c(=O)cc(N4CCOCC4)oc23)c1 |
| InChI | InChI=1S/C21H20N2O6S/c1-3-18(25)23(26)13-4-5-17(27-2)14(10-13)15-12-30-21-16(24)11-19(29-20(15)21)22-6-8-28-9-7-22/h3-5,10-12,26H,1,6-9H2,2H3 |
| InChIKey | HRNKGGFYABPVSM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|