C21H21N3O4S — CID 153397302
5-morpholin-4-yl-3-(4-prop-2-enyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-6-yl)thieno[3,2-b]pyran-7-one (PubChem CID 153397302) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is 5-morpholin-4-yl-3-(4-prop-2-enyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-6-yl)thieno[3,2-b]pyran-7-one.
| Compound Name | 5-morpholin-4-yl-3-(4-prop-2-enyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-6-yl)thieno[3,2-b]pyran-7-one |
|---|---|
| PubChem CID | 153397302 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 5-morpholin-4-yl-3-(4-prop-2-enyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-6-yl)thieno[3,2-b]pyran-7-one |
| SMILES | C=CCN1CCOc2ccc(-c3csc4c(=O)cc(N5CCOCC5)oc34)nc21 |
| InChI | InChI=1S/C21H21N3O4S/c1-2-5-24-8-11-27-17-4-3-15(22-21(17)24)14-13-29-20-16(25)12-18(28-19(14)20)23-6-9-26-10-7-23/h2-4,12-13H,1,5-11H2 |
| InChIKey | GZFSXAATMWHLLK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 68.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|