C21H19FN2O4S2 — CID 153397315
3-(4-ethenylsulfanyl-7-fluoro-2,3-dihydro-1,4-benzoxazin-6-yl)-5-morpholin-4-ylthieno[3,2-b]pyran-7-one (PubChem CID 153397315) has the molecular formula C21H19FN2O4S2 and a molecular weight of 446.53 g/mol. Its IUPAC name is 3-(4-ethenylsulfanyl-7-fluoro-2,3-dihydro-1,4-benzoxazin-6-yl)-5-morpholin-4-ylthieno[3,2-b]pyran-7-one.
| Compound Name | 3-(4-ethenylsulfanyl-7-fluoro-2,3-dihydro-1,4-benzoxazin-6-yl)-5-morpholin-4-ylthieno[3,2-b]pyran-7-one |
|---|---|
| PubChem CID | 153397315 |
| Molecular Formula | C21H19FN2O4S2 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 3-(4-ethenylsulfanyl-7-fluoro-2,3-dihydro-1,4-benzoxazin-6-yl)-5-morpholin-4-ylthieno[3,2-b]pyran-7-one |
| SMILES | C=CSN1CCOc2cc(F)c(-c3csc4c(=O)cc(N5CCOCC5)oc34)cc21 |
| InChI | InChI=1S/C21H19FN2O4S2/c1-2-30-24-5-8-27-18-10-15(22)13(9-16(18)24)14-12-29-21-17(25)11-19(28-20(14)21)23-3-6-26-7-4-23/h2,9-12H,1,3-8H2 |
| InChIKey | KGKKBOJXKSZTBI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|