C28H29N3O3S — CID 142505761
3-[3-[(E)-1-(2-amino-6-hydroxyphenyl)but-1-enyl]phenyl]-5-(4-methylpiperazin-1-yl)thieno[3,2-b]pyran-7-one (PubChem CID 142505761) has the molecular formula C28H29N3O3S and a molecular weight of 487.63 g/mol. Its IUPAC name is 3-[3-[(E)-1-(2-amino-6-hydroxyphenyl)but-1-enyl]phenyl]-5-(4-methylpiperazin-1-yl)thieno[3,2-b]pyran-7-one.
| Compound Name | 3-[3-[(E)-1-(2-amino-6-hydroxyphenyl)but-1-enyl]phenyl]-5-(4-methylpiperazin-1-yl)thieno[3,2-b]pyran-7-one |
|---|---|
| PubChem CID | 142505761 |
| Molecular Formula | C28H29N3O3S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 3-[3-[(E)-1-(2-amino-6-hydroxyphenyl)but-1-enyl]phenyl]-5-(4-methylpiperazin-1-yl)thieno[3,2-b]pyran-7-one |
| SMILES | CC/C=C(\c1cccc(-c2csc3c(=O)cc(N4CCN(C)CC4)oc23)c1)c1c(N)cccc1O |
| InChI | InChI=1S/C28H29N3O3S/c1-3-6-20(26-22(29)9-5-10-23(26)32)18-7-4-8-19(15-18)21-17-35-28-24(33)16-25(34-27(21)28)31-13-11-30(2)12-14-31/h4-10,15-17,32H,3,11-14,29H2,1-2H3/b20-6+ |
| InChIKey | KRAOUIBFMHNCCI-CGOBSMCZSA-N |
| XLogP | 5.40 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|