C20H19N3O3S — CID 146319976
N-[3-(7-oxo-5-piperazin-1-ylthieno[3,2-b]pyran-3-yl)phenyl]prop-2-enamide (PubChem CID 146319976) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is N-[3-(7-oxo-5-piperazin-1-ylthieno[3,2-b]pyran-3-yl)phenyl]prop-2-enamide.
| Compound Name | N-[3-(7-oxo-5-piperazin-1-ylthieno[3,2-b]pyran-3-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146319976 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N-[3-(7-oxo-5-piperazin-1-ylthieno[3,2-b]pyran-3-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2csc3c(=O)cc(N4CCNCC4)oc23)c1 |
| InChI | InChI=1S/C20H19N3O3S/c1-2-17(25)22-14-5-3-4-13(10-14)15-12-27-20-16(24)11-18(26-19(15)20)23-8-6-21-7-9-23/h2-5,10-12,21H,1,6-9H2,(H,22,25) |
| InChIKey | MQKWHHLOMLDWQV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|