C40H37ClN4O6S4 — CID 158939312
3-(3-aminophenyl)-5-morpholin-4-ylthieno[3,2-b]pyran-7-thione;N-[3-(5-morpholin-4-yl-7-sulfanylidenethieno[3,2-b]pyran-3-yl)phenyl]prop-2-enamide;prop-2-enoyl chloride (PubChem CID 158939312) has the molecular formula C40H37ClN4O6S4 and a molecular weight of 833.48 g/mol. Its IUPAC name is 3-(3-aminophenyl)-5-morpholin-4-ylthieno[3,2-b]pyran-7-thione;N-[3-(5-morpholin-4-yl-7-sulfanylidenethieno[3,2-b]pyran-3-yl)phenyl]prop-2-enamide;prop-2-enoyl chloride.
| Compound Name | 3-(3-aminophenyl)-5-morpholin-4-ylthieno[3,2-b]pyran-7-thione;N-[3-(5-morpholin-4-yl-7-sulfanylidenethieno[3,2-b]pyran-3-yl)phenyl]prop-2-enamide;prop-2-enoyl chloride |
|---|---|
| PubChem CID | 158939312 |
| Molecular Formula | C40H37ClN4O6S4 |
| Molecular Weight | 833.48 g/mol |
| Exact Mass | 832.13 |
| IUPAC Name | 3-(3-aminophenyl)-5-morpholin-4-ylthieno[3,2-b]pyran-7-thione;N-[3-(5-morpholin-4-yl-7-sulfanylidenethieno[3,2-b]pyran-3-yl)phenyl]prop-2-enamide;prop-2-enoyl chloride |
| SMILES | C=CC(=O)Cl.C=CC(=O)Nc1cccc(-c2csc3c(=S)cc(N4CCOCC4)oc23)c1.Nc1cccc(-c2csc3c(=S)cc(N4CCOCC4)oc23)c1 |
| InChI | InChI=1S/C20H18N2O3S2.C17H16N2O2S2.C3H3ClO/c1-2-17(23)21-14-5-3-4-13(10-14)15-12-27-20-16(26)11-18(25-19(15)20)22-6-8-24-9-7-22;18-12-3-1-2-11(8-12)13-10-23-17-14(22)9-15(21-16(13)17)19-4-6-20-7-5-19;1-2-3(4)5/h2-5,10-12H,1,6-9H2,(H,21,23);1-3,8-10H,4-7,18H2;2H,1H2 |
| InChIKey | JKAXAGXAWYNVRT-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.48 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|