C21H25NO3S — CID 157029212
3-[(2Z,4E,6E)-7-methylnona-2,4,6-trien-4-yl]-5-morpholin-4-ylthieno[3,2-b]pyran-7-one (PubChem CID 157029212) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is 3-[(2Z,4E,6E)-7-methylnona-2,4,6-trien-4-yl]-5-morpholin-4-ylthieno[3,2-b]pyran-7-one.
| Compound Name | 3-[(2Z,4E,6E)-7-methylnona-2,4,6-trien-4-yl]-5-morpholin-4-ylthieno[3,2-b]pyran-7-one |
|---|---|
| PubChem CID | 157029212 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 3-[(2Z,4E,6E)-7-methylnona-2,4,6-trien-4-yl]-5-morpholin-4-ylthieno[3,2-b]pyran-7-one |
| SMILES | C/C=C\C(=C/C=C(\C)CC)c1csc2c(=O)cc(N3CCOCC3)oc12 |
| InChI | InChI=1S/C21H25NO3S/c1-4-6-16(8-7-15(3)5-2)17-14-26-21-18(23)13-19(25-20(17)21)22-9-11-24-12-10-22/h4,6-8,13-14H,5,9-12H2,1-3H3/b6-4-,15-7+,16-8+ |
| InChIKey | OKQBQMGVYWFXGC-FYZDSWESSA-N |
| XLogP | 5.01 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|