C13H15NO2S — CID 135275988
3-methyl-5-piperidin-1-ylthieno[3,2-b]pyran-7-one (PubChem CID 135275988) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is 3-methyl-5-piperidin-1-ylthieno[3,2-b]pyran-7-one.
| Compound Name | 3-methyl-5-piperidin-1-ylthieno[3,2-b]pyran-7-one |
|---|---|
| PubChem CID | 135275988 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 3-methyl-5-piperidin-1-ylthieno[3,2-b]pyran-7-one |
| SMILES | Cc1csc2c(=O)cc(N3CCCCC3)oc12 |
| InChI | InChI=1S/C13H15NO2S/c1-9-8-17-13-10(15)7-11(16-12(9)13)14-5-3-2-4-6-14/h7-8H,2-6H2,1H3 |
| InChIKey | HGSZYKYWNUUAMU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |