C34H64O5S — CID 146462938
[(13Z,16Z)-3-[8-(1,3-dioxolan-2-yl)octyl]docosa-13,16-dienyl] methanesulfonate (PubChem CID 146462938) has the molecular formula C34H64O5S and a molecular weight of 584.95 g/mol. Its IUPAC name is [(13Z,16Z)-3-[8-(1,3-dioxolan-2-yl)octyl]docosa-13,16-dienyl] methanesulfonate.
| Compound Name | [(13Z,16Z)-3-[8-(1,3-dioxolan-2-yl)octyl]docosa-13,16-dienyl] methanesulfonate |
|---|---|
| PubChem CID | 146462938 |
| Molecular Formula | C34H64O5S |
| Molecular Weight | 584.95 g/mol |
| Exact Mass | 584.45 |
| IUPAC Name | [(13Z,16Z)-3-[8-(1,3-dioxolan-2-yl)octyl]docosa-13,16-dienyl] methanesulfonate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(CCCCCCCCC1OCCO1)CCOS(C)(=O)=O |
| InChI | InChI=1S/C34H64O5S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-23-26-33(29-30-39-40(2,35)36)27-24-21-18-19-22-25-28-34-37-31-32-38-34/h7-8,10-11,33-34H,3-6,9,12-32H2,1-2H3/b8-7-,11-10- |
| InChIKey | ALLVSNGDGCDDTL-NQLNTKRDSA-N |
| XLogP | 10.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.95 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|