C7H16Cl2N2 — CID 146472088
bicyclo[4.1.0]heptane-3,4-diamine;dihydrochloride (PubChem CID 146472088) has the molecular formula C7H16Cl2N2 and a molecular weight of 199.12 g/mol. Its IUPAC name is bicyclo[4.1.0]heptane-3,4-diamine;dihydrochloride.
| Compound Name | bicyclo[4.1.0]heptane-3,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 146472088 |
| Molecular Formula | C7H16Cl2N2 |
| Molecular Weight | 199.12 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | bicyclo[4.1.0]heptane-3,4-diamine;dihydrochloride |
| SMILES | Cl.Cl.NC1CC2CC2CC1N |
| InChI | InChI=1S/C7H14N2.2ClH/c8-6-2-4-1-5(4)3-7(6)9;;/h4-7H,1-3,8-9H2;2*1H |
| InChIKey | UMKPQRVACZJIFH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.12 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |