C19H19FN4O2S — CID 146477459
4-[(Z)-2-(aminomethyl)-4-(fluoroamino)but-2-enoxy]-N-(1,3-benzothiazol-2-yl)benzamide (PubChem CID 146477459) has the molecular formula C19H19FN4O2S and a molecular weight of 386.45 g/mol. Its IUPAC name is 4-[(Z)-2-(aminomethyl)-4-(fluoroamino)but-2-enoxy]-N-(1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-[(Z)-2-(aminomethyl)-4-(fluoroamino)but-2-enoxy]-N-(1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 146477459 |
| Molecular Formula | C19H19FN4O2S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 4-[(Z)-2-(aminomethyl)-4-(fluoroamino)but-2-enoxy]-N-(1,3-benzothiazol-2-yl)benzamide |
| SMILES | NC/C(=C/CNF)COc1ccc(C(=O)Nc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H19FN4O2S/c20-22-10-9-13(11-21)12-26-15-7-5-14(6-8-15)18(25)24-19-23-16-3-1-2-4-17(16)27-19/h1-9,22H,10-12,21H2,(H,23,24,25)/b13-9- |
| InChIKey | DGEQYOAFMINXMD-LCYFTJDESA-N |
| XLogP | 3.29 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|