C7H14N4O — CID 146481527
2-[[(Z)-3-amino-3-iminoprop-1-enyl]amino]-2-methylpropanamide (PubChem CID 146481527) has the molecular formula C7H14N4O and a molecular weight of 170.22 g/mol. Its IUPAC name is 2-[[(Z)-3-amino-3-iminoprop-1-enyl]amino]-2-methylpropanamide.
| Compound Name | 2-[[(Z)-3-amino-3-iminoprop-1-enyl]amino]-2-methylpropanamide |
|---|---|
| PubChem CID | 146481527 |
| Molecular Formula | C7H14N4O |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | 2-[[(Z)-3-amino-3-iminoprop-1-enyl]amino]-2-methylpropanamide |
| SMILES | [H]/N=C(N)/C=C\NC(C)(C)C(N)=O |
| InChI | InChI=1S/C7H14N4O/c1-7(2,6(10)12)11-4-3-5(8)9/h3-4,11H,1-2H3,(H3,8,9)(H2,10,12)/b4-3- |
| InChIKey | PRUAYDUENDRVKY-ARJAWSKDSA-N |
| XLogP | -0.71 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|