C17H26N2OS — CID 14649209
(2R,5R)-3-methyl-5-octyl-2-pyridin-3-yl-1,3-thiazolidin-4-one (PubChem CID 14649209) has the molecular formula C17H26N2OS and a molecular weight of 306.47 g/mol. Its IUPAC name is (2R,5R)-3-methyl-5-octyl-2-pyridin-3-yl-1,3-thiazolidin-4-one.
| Compound Name | (2R,5R)-3-methyl-5-octyl-2-pyridin-3-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 14649209 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (2R,5R)-3-methyl-5-octyl-2-pyridin-3-yl-1,3-thiazolidin-4-one |
| SMILES | CCCCCCCC[C@H]1S[C@H](c2cccnc2)N(C)C1=O |
| InChI | InChI=1S/C17H26N2OS/c1-3-4-5-6-7-8-11-15-16(20)19(2)17(21-15)14-10-9-12-18-13-14/h9-10,12-13,15,17H,3-8,11H2,1-2H3/t15-,17-/m1/s1 |
| InChIKey | VILHDFUQASSGLR-NVXWUHKLSA-N |
| XLogP | 4.40 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|